3-bromopropyl-[3-bromopropyl(dimethyl)silyl]oxy-dimethylsilane structure
|
Common Name | 3-bromopropyl-[3-bromopropyl(dimethyl)silyl]oxy-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 18132-70-2 | Molecular Weight | 376.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H24Br2OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromopropyl-[3-bromopropyl(dimethyl)silyl]oxy-dimethylsilane |
|---|
| Molecular Formula | C10H24Br2OSi2 |
|---|---|
| Molecular Weight | 376.27600 |
| Exact Mass | 373.97300 |
| PSA | 9.23000 |
| LogP | 4.98320 |
| InChIKey | PMAMLBZGMZOYAC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCBr)O[Si](C)(C)CCCBr |
|
~%
3-bromopropyl-[... CAS#:18132-70-2 |
| Literature: Sommer et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 2485,2486,2488 |