2-Iodo-4,6-bis(trifluoromethyl)pyridine
Modify Date: 2025-09-09 17:34:24
2-Iodo-4,6-bis(trifluoromethyl)pyridine structure
|
Common Name | 2-Iodo-4,6-bis(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1806575-55-2 | Molecular Weight | 340.99 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H2F6IN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Iodo-4,6-bis(trifluoromethyl)pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H2F6IN |
|---|---|
| Molecular Weight | 340.99 |
| InChIKey | ZZQFNACXZDDIKE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(I)nc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: InChIKey of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is ZZQFNACXZDDIKE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: CAS number of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is 1806575-55-2. |
| Q: What is the Chinese name of 1806575-55-2? |
| A: Chinese name of 1806575-55-2 is 1806575-55-2. |
| Q: What is the SMILES notation of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: SMILES notation of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is FC(F)(F)c1cc(I)nc(C(F)(F)F)c1. |
| Q: What is the molecular weight of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: Molecular weight of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is 340.99. |
| Q: What is the molecular formula of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: Molecular formula of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is C7H2F6IN. |
| Q: What is the English name of 2-Iodo-4,6-bis(trifluoromethyl)pyridine? |
| A: The English name of 2-Iodo-4,6-bis(trifluoromethyl)pyridine is 2-Iodo-4,6-bis(trifluoromethyl)pyridine. |