3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid
Modify Date: 2025-08-21 17:07:47
3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid structure
|
Common Name | 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1781663-25-9 | Molecular Weight | 258.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13F3O2 |
|---|---|
| Molecular Weight | 258.24 |
| InChIKey | KAUJXSIOYXVYNI-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1ccc2c(c1)CCC2)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: Molecular formula of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is C13H13F3O2. |
| Q: What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: InChIKey of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is KAUJXSIOYXVYNI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1781663-25-9? |
| A: Chinese name of 1781663-25-9 is 1781663-25-9. |
| Q: What is the molecular weight of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: Molecular weight of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is 258.24. |
| Q: What is the CAS number of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: CAS number of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is 1781663-25-9. |
| Q: What is the English name of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: The English name of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid. |
| Q: What is the SMILES notation of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid? |
| A: SMILES notation of 3-(2,3-dihydro-1H-inden-5-yl)-4,4,4-trifluorobutanoic acid is O=C(O)CC(c1ccc2c(c1)CCC2)C(F)(F)F. |