2-methylphenanthrene-9,10-dione
Modify Date: 2025-09-18 20:11:18
2-methylphenanthrene-9,10-dione structure
|
Common Name | 2-methylphenanthrene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 159530-25-3 | Molecular Weight | 222.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylphenanthrene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O2 |
|---|---|
| Molecular Weight | 222.23900 |
| Exact Mass | 222.06800 |
| PSA | 34.14000 |
| LogP | 3.04100 |
| InChIKey | LIRMPWAMAFHSJU-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)c1ccccc1-2 |
|
~%
2-methylphenant... CAS#:159530-25-3 |
| Literature: Haworth Journal of the Chemical Society, 1932 , p. 1125,1131 |
|
~%
2-methylphenant... CAS#:159530-25-3 |
| Literature: Haworth Journal of the Chemical Society, 1932 , p. 1125,1131 |
| 9,10-Phenanthrenedione,2-methyl |
| 2-methyl-phenanthrene-9,10-dione |
| 2-Methyl-phenanthren-9,10-dion |