7-chloro-N-(cyclopropylmethyl)-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine structure
|
Common Name | 7-chloro-N-(cyclopropylmethyl)-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine | ||
|---|---|---|---|---|
| CAS Number | 15687-07-7 | Molecular Weight | 339.81900 | |
| Density | 1.35g/cm3 | Boiling Point | 496.2ºC at 760mmHg | |
| Molecular Formula | C19H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9ºC | |
| Name | 7-chloro-N-(cyclopropylmethyl)-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 496.2ºC at 760mmHg |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.81900 |
| Flash Point | 253.9ºC |
| Exact Mass | 339.11400 |
| PSA | 53.14000 |
| LogP | 4.01850 |
| Vapour Pressure | 1.15E-10mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | CDAZYPQZWWYWDX-UHFFFAOYSA-N |
| SMILES | ON1CC(=NCC2CC2)N=c2ccc(Cl)cc2=C1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cyprazepam |
| Cyprazepamum [INN-Latin] |
| (7-chloro-4-oxy-5-phenyl-3H-benzo[e][1,4]diazepin-2-yl)-cyclopropylmethyl-amine |
| Cyprazepam [USAN:INN] |
| 3H-1,4-BENZODIAZEPINE,7-CHLORO-2-((CYCLOPROPYLMETHYL)AMINO)-5-PHENYL-,4-OXIDE |
| W 3623 |
| 3H-1,4-Benzodiazepin-2-amine,7-chloro-N-(cyclopropylmethyl)-5-phenyl-,4-oxide |
| 7-Chloro-2-((cyclopropylmethyl)amino)-5-phenyl-3H-1,4-benzodiazepine 4-oxide |
| Ciprazepam [INN-Spanish] |