5-(4-amino-2-methoxyphenoxy)-1-phenylpentan-1-one structure
|
Common Name | 5-(4-amino-2-methoxyphenoxy)-1-phenylpentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 15382-92-0 | Molecular Weight | 299.36400 | |
| Density | 1.128g/cm3 | Boiling Point | 489.5ºC at 760mmHg | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8ºC | |
| Name | 5-(4-amino-2-methoxyphenoxy)-1-phenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 489.5ºC at 760mmHg |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.36400 |
| Flash Point | 209.8ºC |
| Exact Mass | 299.15200 |
| PSA | 61.55000 |
| LogP | 4.29060 |
| Vapour Pressure | 9.92E-10mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | XTLPAOIIEZQJDF-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1OCCCCC(=O)c1ccccc1 |
|
~%
5-(4-amino-2-me... CAS#:15382-92-0 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
| 3-Methoxy-4-<4-benzoyl-butyloxy>-anilin |
| 5-(4-Amino-2-methoxyphenoxy)valerophenone |
| B 5114 |
| M &Valerophenone,5-(4-amino-2-methoxyphenoxy) |
| 1-Benzoyl-4-<4-amino-2-methoxy-phenoxy>-butan |