5-(4-amino-2-methoxyphenoxy)-3,3-diethyl-2,2-dihydroxy-1-phenylpentan-1-one structure
|
Common Name | 5-(4-amino-2-methoxyphenoxy)-3,3-diethyl-2,2-dihydroxy-1-phenylpentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 15382-91-9 | Molecular Weight | 387.46900 | |
| Density | 1.187g/cm3 | Boiling Point | 584.4ºC at 760 mmHg | |
| Molecular Formula | C22H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-amino-2-methoxyphenoxy)-3,3-diethyl-2,2-dihydroxy-1-phenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 584.4ºC at 760 mmHg |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.46900 |
| Exact Mass | 387.20500 |
| PSA | 102.01000 |
| LogP | 3.99770 |
| Vapour Pressure | 1.67E-14mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | KAKMOXRQOSVRCW-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CCOc1ccc(N)cc1OC)C(O)(O)C(=O)c1ccccc1 |
|
~%
5-(4-amino-2-me... CAS#:15382-91-9 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
|
~%
5-(4-amino-2-me... CAS#:15382-91-9 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
| 5-(4-Amino-2-methoxyphenoxy)valerophenone diethyl acetal |
| Valerophenone,5-(4-amino-2-methoxyphenoxy)-,diethyl acetal |
| 5-<4-Amino-2-methoxy-phenoxy>-1-phenyl-pentanon-(1)-diaethylacetal |
| B 5378 |