[5-(4-amino-2-methoxyphenoxy)-1-phenylpentyl] acetate structure
|
Common Name | [5-(4-amino-2-methoxyphenoxy)-1-phenylpentyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 15382-89-5 | Molecular Weight | 343.41700 | |
| Density | 1.13g/cm3 | Boiling Point | 508.3ºC at 760mmHg | |
| Molecular Formula | C20H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | [5-(4-amino-2-methoxyphenoxy)-1-phenylpentyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 508.3ºC at 760mmHg |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.41700 |
| Flash Point | 192.1ºC |
| Exact Mass | 343.17800 |
| PSA | 70.78000 |
| LogP | 4.71210 |
| Vapour Pressure | 1.88E-10mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | XGBKDGNFNMLQKG-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1OCCCCC(OC(C)=O)c1ccccc1 |
|
~%
[5-(4-amino-2-m... CAS#:15382-89-5 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
| 5-(4-amino-2-methoxyphenoxy)-1-phenylpentyl acetate |
| M &B 5269 |
| 1-Acetoxy-5-(4-amino-2-methoxy-phenoxy)-1-phenyl-pentan |