3-methoxy-4-[(4-methylsulfonylphenyl)methoxy]aniline structure
|
Common Name | 3-methoxy-4-[(4-methylsulfonylphenyl)methoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 15382-83-9 | Molecular Weight | 307.36500 | |
| Density | 1.269g/cm3 | Boiling Point | 528.1ºC at 760mmHg | |
| Molecular Formula | C15H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.2ºC | |
| Name | 3-methoxy-4-[(4-methylsulfonylphenyl)methoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 528.1ºC at 760mmHg |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.36500 |
| Flash Point | 273.2ºC |
| Exact Mass | 307.08800 |
| PSA | 87.00000 |
| LogP | 3.92190 |
| Vapour Pressure | 3.05E-11mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | ZVUGDPBSFGGYEO-UHFFFAOYSA-N |
| SMILES | COc1cc(N)ccc1OCc1ccc(S(C)(=O)=O)cc1 |
|
~%
3-methoxy-4-[(4... CAS#:15382-83-9 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
|
~%
3-methoxy-4-[(4... CAS#:15382-83-9 |
| Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society, 1961 , p. 1863 - 1879 |
| 4-((p-(Methylsulfonyl)benzyl)oxy)-m-anisidine |
| m-Anisidine,4-((p-(methylsulfonyl)benzyl)oxy) |
| B 5542 |