2-methoxy-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine structure
|
Common Name | 2-methoxy-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 15221-81-5 | Molecular Weight | 233.23000 | |
| Density | 1.139g/cm3 | Boiling Point | 227.5ºC at 760mmHg | |
| Molecular Formula | C11H14F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.4ºC | |
| Name | 2-methoxy-N-methyl-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 227.5ºC at 760mmHg |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23000 |
| Flash Point | 91.4ºC |
| Exact Mass | 233.10300 |
| PSA | 21.26000 |
| LogP | 3.00320 |
| Vapour Pressure | 0.0771mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | CXLOIJUDIPVKOU-UHFFFAOYSA-N |
| SMILES | CNCC(OC)c1cccc(C(F)(F)F)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Fludorex (USAN) |
| FLUDOREX |
| UNII-346FQP00BI |