5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate
Modify Date: 2026-06-25 12:29:18
5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate structure
|
Common Name | 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate | ||
|---|---|---|---|---|
| CAS Number | 1428362-23-5 | Molecular Weight | 451.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H25N3O6 |
|---|---|
| Molecular Weight | 451.5 |
| InChIKey | JXNVTNBPSYPWEJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)O.c1ccc(COc2ccc(CN3CC(c4nc(C5CC5)no4)C3)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: Molecular formula of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is C24H25N3O6. |
| Q: What is the InChIKey of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: InChIKey of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is JXNVTNBPSYPWEJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: SMILES notation of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is O=C(O)C(=O)O.c1ccc(COc2ccc(CN3CC(c4nc(C5CC5)no4)C3)cc2)cc1. |
| Q: What is the English name of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: The English name of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate. |
| Q: What is the CAS number of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: CAS number of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is 1428362-23-5. |
| Q: What is the molecular weight of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate? |
| A: Molecular weight of 5-(1-(4-(Benzyloxy)benzyl)azetidin-3-yl)-3-cyclopropyl-1,2,4-oxadiazole oxalate is 451.5. |
| Q: What is the Chinese name of 1428362-23-5? |
| A: Chinese name of 1428362-23-5 is 1428362-23-5. |