1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine
Modify Date: 2025-09-29 18:26:20
1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine structure
|
Common Name | 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 1428362-17-7 | Molecular Weight | 397.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22Cl2N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22Cl2N2O2S2 |
|---|---|
| Molecular Weight | 397.4 |
| InChIKey | NVOFPMGEMNKTNB-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)N2CCCSCC2CN(C)C)c(Cl)cc1Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: SMILES notation of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is Cc1cc(S(=O)(=O)N2CCCSCC2CN(C)C)c(Cl)cc1Cl. |
| Q: What is the molecular formula of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: Molecular formula of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is C15H22Cl2N2O2S2. |
| Q: What is the English name of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: The English name of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine. |
| Q: What is the InChIKey of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: InChIKey of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is NVOFPMGEMNKTNB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: CAS number of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is 1428362-17-7. |
| Q: What is the molecular weight of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine? |
| A: Molecular weight of 1-(4-((2,4-dichloro-5-methylphenyl)sulfonyl)-1,4-thiazepan-3-yl)-N,N-dimethylmethanamine is 397.4. |
| Q: What is the Chinese name of 1428362-17-7? |
| A: Chinese name of 1428362-17-7 is 1428362-17-7. |