2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione
Modify Date: 2026-07-28 17:00:28
![2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione Structure](https://www.chemsrc.com/extcaspic/023/1428362-15-5.png)
2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione structure
|
Common Name | 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1428362-15-5 | Molecular Weight | 372.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2O5 |
|---|---|
| Molecular Weight | 372.4 |
| InChIKey | HVPFOYZNIUBQHF-UHFFFAOYSA-N |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCOC2(CCOCC2)C1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: CAS number of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is 1428362-15-5. |
| Q: What is the molecular weight of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: Molecular weight of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is 372.4. |
| Q: What is the Chinese name of 1428362-15-5? |
| A: Chinese name of 1428362-15-5 is 1428362-15-5. |
| Q: What is the InChIKey of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: InChIKey of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is HVPFOYZNIUBQHF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: SMILES notation of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCOC2(CCOCC2)C1. |
| Q: What is the molecular formula of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: Molecular formula of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is C20H24N2O5. |
| Q: What is the English name of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione? |
| A: The English name of 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione is 2-(4-Oxo-4-(1,9-dioxa-4-azaspiro[5.5]undecan-4-yl)butyl)isoindoline-1,3-dione. |