4Cmj5PF9AD
Modify Date: 2026-07-18 07:55:35
4Cmj5PF9AD structure
|
Common Name | 4Cmj5PF9AD | ||
|---|---|---|---|---|
| CAS Number | 1428362-10-0 | Molecular Weight | 598.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H30N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4Cmj5PF9AD |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H30N6O7 |
|---|---|
| Molecular Weight | 598.6 |
| InChIKey | WIAUQKAIELDIJJ-WLHGVMLRSA-N |
| SMILES | CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(C#N)cc1)n2C)c1ccccn1.O=C(O)C=CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4Cmj5PF9AD? |
| A: CAS number of 4Cmj5PF9AD is 1428362-10-0. |
| Q: What is the InChIKey of 4Cmj5PF9AD? |
| A: InChIKey of 4Cmj5PF9AD is WIAUQKAIELDIJJ-WLHGVMLRSA-N. |
| Q: What is the molecular weight of 4Cmj5PF9AD? |
| A: Molecular weight of 4Cmj5PF9AD is 598.6. |
| Q: What is the Chinese name of 1428362-10-0? |
| A: Chinese name of 1428362-10-0 is 1428362-10-0. |
| Q: What is the English name of 4Cmj5PF9AD? |
| A: The English name of 4Cmj5PF9AD is 4Cmj5PF9AD. |
| Q: What is the SMILES notation of 4Cmj5PF9AD? |
| A: SMILES notation of 4Cmj5PF9AD is CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc1ccc(C#N)cc1)n2C)c1ccccn1.O=C(O)C=CC(=O)O. |
| Q: What is the molecular formula of 4Cmj5PF9AD? |
| A: Molecular formula of 4Cmj5PF9AD is C31H30N6O7. |