3,4-dihydroxy-1-phenylpyrrolidine-2,5-dione structure
|
Common Name | 3,4-dihydroxy-1-phenylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 142082-55-1 | Molecular Weight | 207.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dihydroxy-1-phenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO4 |
|---|---|
| Molecular Weight | 207.18300 |
| Exact Mass | 207.05300 |
| PSA | 77.84000 |
| InChIKey | VVCQJDHMWMRSEC-UHFFFAOYSA-N |
| SMILES | O=C1C(O)C(O)C(=O)N1c1ccccc1 |
|
~%
3,4-dihydroxy-1... CAS#:142082-55-1 |
| Literature: Casale Gazzetta Chimica Italiana, 1917 , vol. 47 I, p. 275 Full Text Show Details Frankland; Slator Journal of the Chemical Society, 1903 , vol. 83, p. 1365 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,4-Dihydroxy-1-phenyl-pyrrolidin-2,5-dion |
| 3,4-dihydroxy-1-phenyl-pyrrolidine-2,5-dione |
| 2,5-Pyrrolidinedione,3,4-dihydroxy-1-phenyl |