5-(3-nitropropyl)-5,6,7,8-tetrahydronaphthalen-2-ol structure
|
Common Name | 5-(3-nitropropyl)-5,6,7,8-tetrahydronaphthalen-2-ol | ||
|---|---|---|---|---|
| CAS Number | 136859-09-1 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-nitropropyl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 66.05000 |
| LogP | 3.39220 |
| InChIKey | MNPVILFMWDQVAV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CCCC1CCCc2cc(O)ccc21 |
|
~48%
5-(3-nitropropy... CAS#:136859-09-1 |
| Literature: Hares, Owen; Hobbs-Mallyon, David; Whiting, Donald A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 13 p. 1481 - 1492 |
|
~%
5-(3-nitropropy... CAS#:136859-09-1 |
| Literature: Hobbs-Mallyon, David; Whiting, Donald A. Journal of the Chemical Society, Chemical Communications, 1991 , # 13 p. 899 - 900 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,6,7,8-tetrahydro-5-(3-nitropropyl)-2-naphthol |
| 2-Naphthalenol,5,6,7,8-tetrahydro-5-(3-nitropropyl) |