1-(3-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine
Modify Date: 2024-07-18 18:52:04
1-(3-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine structure
|
Common Name | 1-(3-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 13351-02-5 | Molecular Weight | 251.71500 | |
| Density | 1.4g/cm3 | Boiling Point | 400.8ºC at 760mmHg | |
| Molecular Formula | C11H14ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
| Name | 1-(3-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760mmHg |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.71500 |
| Flash Point | 196.2ºC |
| Exact Mass | 251.09400 |
| PSA | 75.00000 |
| LogP | 2.86690 |
| Vapour Pressure | 1.24E-06mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | AXIUXECRTOGILY-UHFFFAOYSA-N |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1cccc(Cl)c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1-(3-chloro-phenyl)-6,6-dimethyl-1,6-dihydro-[1,3,5]triazine-2,4-diamine |
| D 69 |
| 1,3,5-Triazine-2,4-diamine,1-(3-chlorophenyl)-1,6-dihydro-6,6-dimethyl |
| 1-(3-chlorophenyl)-4,6-diamino-1,2-dihydro-2,2-dimethyl-1,3,5-triazine |
| X 48 |