Dibenz(a,j)anthracene trans-3,4-diol-syn-1,2-epoxide,compd. with perchloric acid structure
|
Common Name | Dibenz(a,j)anthracene trans-3,4-diol-syn-1,2-epoxide,compd. with perchloric acid | ||
|---|---|---|---|---|
| CAS Number | 124578-22-9 | Molecular Weight | 428.81900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17ClO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dibenz(a,j)anthracene trans-3,4-diol-syn-1,2-epoxide,compd. with perchloric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H17ClO7 |
|---|---|
| Molecular Weight | 428.81900 |
| Exact Mass | 428.06600 |
| PSA | 124.43000 |
| LogP | 4.15030 |
| Vapour Pressure | 1.56E-17mmHg at 25°C |
| InChIKey | RVMXLUVNZYQCAA-ITHQHCIYSA-N |
| SMILES | OC1c2ccc3cc4ccc5ccccc5c4cc3c2C2OC2C1O.[O-][Cl+3]([O-])([O-])O |
| Naphtho(1',2':6,7)phenanthro(3,4-b)oxirene-2,3-diol,1a,2,3,13c-tetrahydro-,(1aalpha,2alpha,3beta,13calpha)-,compd. with perchloric acid (1:1) |