tert-butyl-[tert-butyl(diphenyl)silyl]-diphenylsilane structure
|
Common Name | tert-butyl-[tert-butyl(diphenyl)silyl]-diphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 122131-73-1 | Molecular Weight | 478.81500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H38Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-[tert-butyl(diphenyl)silyl]-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H38Si2 |
|---|---|
| Molecular Weight | 478.81500 |
| Exact Mass | 478.25100 |
| LogP | 6.19140 |
| InChIKey | MYGACGYHGHVXFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
|
~97%
tert-butyl-[ter... CAS#:122131-73-1 |
| Literature: Fuerstner, Alois; Weidmann, Hans Journal of Organometallic Chemistry, 1988 , vol. 354, p. 15 - 22 |
|
~%
tert-butyl-[ter... CAS#:122131-73-1 |
| Literature: Pandey, Ganesh; Sesha Poleswara Rao; Palit; Mittal Journal of Organic Chemistry, 1998 , vol. 63, # 12 p. 3968 - 3978 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,2-di-tert-butyl-1,1,2,2-tetraphenyldisilane |
| 1,1,2,2-tetraphenyl-1,2-di-tert-butyl-1,2-disilane |
| Disilane,1,2-bis(1,1-dimethylethyl)-1,1,2,2-tetraphenyl |
| 1,2-Di-tert-butyl-1,1,2,2-tetraphenyldisilan |