5-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrimidine-2,4-diamine structure
|
Common Name | 5-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrimidine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 121936-22-9 | Molecular Weight | 286.32900 | |
| Density | 1.213g/cm3 | Boiling Point | 529.2ºC at 760 mmHg | |
| Molecular Formula | C15H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.9ºC | |
| Name | 5-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 529.2ºC at 760 mmHg |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.32900 |
| Flash Point | 273.9ºC |
| Exact Mass | 286.14300 |
| PSA | 97.74000 |
| LogP | 1.66540 |
| Vapour Pressure | 2.75E-11mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | HIBNJZOVXZFUJA-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(Cc2cnc(N)nc2N)cc1OC |
|
~55%
5-[(3-methoxy-4... CAS#:121936-22-9 |
| Literature: Roth; Tidwell; Ferone; Baccanari; Sigel; DeAngelis; Elwell Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1949 - 1958 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,4-Pyrimidinediamine,5-((3-methoxy-4-(2-propenyloxy)phenyl)methyl) |
| 5-((3-Methoxy-4-(2-propenyloxy)phenyl)methyl)-2,4-pyrimidinediamine |
| 2,4-Diamino-5-(3-methoxy-4-allyloxybenzyl)pyrimidine hydrochloride |
| 2,4-diamino-5-[3-methoxy-4-(allyloxy)benzyl]pyrimidine |