4-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine structure
|
Common Name | 4-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine | ||
|---|---|---|---|---|
| CAS Number | 120533-37-1 | Molecular Weight | 293.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17BrN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17BrN2 |
|---|---|
| Molecular Weight | 293.20200 |
| Exact Mass | 292.05800 |
| PSA | 6.48000 |
| LogP | 3.73430 |
| InChIKey | GYLDAZCRYBOLCY-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(Br)ccc(N(C)C)c12 |
|
~78%
4-bromo-1-N,1-N... CAS#:120533-37-1 |
| Literature: Yousefi-Seyf, Jaber; Tajeian, Kazem; Kolvari, Eskandar; Koukabi, Nadiya; Khazaei, Ardeshir; Zolfigol, Mohammad Ali Bulletin of the Korean Chemical Society, 2012 , vol. 33, # 8 p. 2619 - 2622 |
|
~%
4-bromo-1-N,1-N... CAS#:120533-37-1 |
| Literature: Ozeryanskii; Pozharskii Russian Chemical Bulletin, 1997 , vol. 46, # 8 p. 1437 - 1440 |
|
~25%
4-bromo-1-N,1-N... CAS#:120533-37-1 |
| Literature: Ozeryanskii; Pozharskii Russian Chemical Bulletin, 1997 , vol. 46, # 8 p. 1437 - 1440 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS1398E13 |
| 1,8-Naphthalenediamine,4-bromo-N,N,N',N'-tetramethyl |