4,8,13,17,21-pentamethyldocosan-1-ol structure
|
Common Name | 4,8,13,17,21-pentamethyldocosan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 118599-25-0 | Molecular Weight | 396.73300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H56O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,8,13,17,21-pentamethyldocosan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H56O |
|---|---|
| Molecular Weight | 396.73300 |
| Exact Mass | 396.43300 |
| PSA | 20.23000 |
| LogP | 9.03060 |
| InChIKey | XHTUUQNKECQODO-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCO |
|
~67%
4,8,13,17,21-pe... CAS#:118599-25-0 |
| Literature: Arpicco, Silvia; Canevari, Silvana; Ceruti, Maurizio; Galmozzi, Enrico; Rocco, Flavio; Cattel, Luigi Farmaco, 2004 , vol. 59, # 11 p. 869 - 878 |
|
~%
4,8,13,17,21-pe... CAS#:118599-25-0 |
| Literature: Sen, Stephanie E.; Prestwich, Glenn D. Journal of the American Chemical Society, 1989 , vol. 111, # 4 p. 1508 - 1510 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Trisnorsqualene alcohol |
| 1-Docosanol,4,8,13,17,21-pentamethyl |