4-[2-(3,5-dimethoxyphenyl)ethyl]phenol
Modify Date: 2025-10-09 15:38:59
![4-[2-(3,5-dimethoxyphenyl)ethyl]phenol Structure](https://image.chemsrc.com/caspic/043/116518-94-6.png)
4-[2-(3,5-dimethoxyphenyl)ethyl]phenol structure
|
Common Name | 4-[2-(3,5-dimethoxyphenyl)ethyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 116518-94-6 | Molecular Weight | 258.31200 | |
| Density | 1.126g/cm3 | Boiling Point | 400.1ºC at 760mmHg | |
| Molecular Formula | C16H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 4-[2-(3,5-dimethoxyphenyl)ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 400.1ºC at 760mmHg |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31200 |
| Flash Point | 195.8ºC |
| Exact Mass | 258.12600 |
| PSA | 38.69000 |
| LogP | 3.19460 |
| Vapour Pressure | 5.63E-07mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | WOOTZIKTRHIJPN-UHFFFAOYSA-N |
| SMILES | COc1cc(CCc2ccc(O)cc2)cc(OC)c1 |
|
~96%
4-[2-(3,5-dimet... CAS#:116518-94-6 |
| Literature: Mizuno, Cassia S.; Ma, Guoyi; Khan, Shabana; Patny, Akshay; Avery, Mitchell A.; Rimando, Agnes M. Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 7 p. 3800 - 3808 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,5-di-O-methyldihydroresveratrol |
| dihydropterostilbene |
| 4'-hydroxy-3,5-dimethoxy-bibenzyl |