5-(2,4-difluorophenyl)-2-hydroxybenzaldehyde
Modify Date: 2024-04-09 17:32:42
5-(2,4-difluorophenyl)-2-hydroxybenzaldehyde structure
|
Common Name | 5-(2,4-difluorophenyl)-2-hydroxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 114937-29-0 | Molecular Weight | 234.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2,4-difluorophenyl)-2-hydroxybenzaldehyde |
|---|
| Molecular Formula | C13H8F2O2 |
|---|---|
| Molecular Weight | 234.19800 |
| Exact Mass | 234.04900 |
| PSA | 37.30000 |
| LogP | 3.14990 |
| InChIKey | QPNOPMDDTQEIIG-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(-c2ccc(F)cc2F)ccc1O |
|
~78%
5-(2,4-difluoro... CAS#:114937-29-0 |
| Literature: Chiarino; Ferrario; Pellacini; Sala Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 589 - 593 |
|
~%
5-(2,4-difluoro... CAS#:114937-29-0 |
| Literature: Chiarino; Ferrario; Pellacini; Sala Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 589 - 593 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |