3-nitro-4-octanoyloxybenzoic acid structure
|
Common Name | 3-nitro-4-octanoyloxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 113894-26-1 | Molecular Weight | 309.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitro-4-octanoyloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19NO6 |
|---|---|
| Molecular Weight | 309.31400 |
| Exact Mass | 309.12100 |
| PSA | 109.42000 |
| LogP | 4.08210 |
| InChIKey | OLVAECPSQIIVEN-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)Oc1ccc(C(=O)O)cc1[N+](=O)[O-] |
|
~%
3-nitro-4-octan... CAS#:113894-26-1 |
| Literature: Tee, Oswald S.; Du, Xian-Xian Journal of the American Chemical Society, 1992 , vol. 114, # 2 p. 620 - 627 |
| 4-carboxy-2-nitrophenyl octanoate |