2-chloro-N-(4-methylphenyl)sulfonylpyridine-3-carboxamide structure
|
Common Name | 2-chloro-N-(4-methylphenyl)sulfonylpyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 113513-63-6 | Molecular Weight | 310.75600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(4-methylphenyl)sulfonylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11ClN2O3S |
|---|---|
| Molecular Weight | 310.75600 |
| Exact Mass | 310.01800 |
| PSA | 88.00000 |
| LogP | 3.81770 |
| InChIKey | ZDXJEAOWBMHNTI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2cccnc2Cl)cc1 |
|
~74%
2-chloro-N-(4-m... CAS#:113513-63-6 |
| Literature: Zhang, Hui; Lu, Xiang; Zhang, Li-Rong; Liu, Jia-Jia; Yang, Xian-Hui; Wang, Xiao-Ming; Zhu, Hai-Liang Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 4 p. 1411 - 1416 |
|
~92%
2-chloro-N-(4-m... CAS#:113513-63-6 |
| Literature: Wang, Feng; Liu, Hongxia; Fu, Hua; Jiang, Yuyang; Zhao, Yufen Advanced Synthesis and Catalysis, 2009 , vol. 351, # 1-2 p. 246 - 252 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(2-chloro-3-pyridinecarbonyl)-4-methyl-benzenesulfonamide |
| 3-Pyridinecarboxamide,2-chloro-N-[(4-methylphenyl)sulfonyl] |
| 2-chloro-N-tosylnicotinamide |