N-(2,4-dibromophenyl)-4-methylbenzenesulfonamide structure
|
Common Name | N-(2,4-dibromophenyl)-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 112970-57-7 | Molecular Weight | 405.10500 | |
| Density | 1.783g/cm3 | Boiling Point | 463.5ºC at 760mmHg | |
| Molecular Formula | C13H11Br2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.1ºC | |
| Name | N-(2,4-dibromophenyl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.783g/cm3 |
|---|---|
| Boiling Point | 463.5ºC at 760mmHg |
| Molecular Formula | C13H11Br2NO2S |
| Molecular Weight | 405.10500 |
| Flash Point | 234.1ºC |
| Exact Mass | 402.88800 |
| PSA | 54.55000 |
| LogP | 5.47460 |
| Vapour Pressure | 9.06E-09mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | YWXYWLQWHOHUPX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Br)cc2Br)cc1 |
|
~76%
N-(2,4-dibromop... CAS#:112970-57-7 |
| Literature: Krolski, Michael E.; Renaldo, Alfred F.; Rudisill, Duane E.; Stille, J. K. Journal of Organic Chemistry, 1988 , vol. 53, # 6 p. 1170 - 1176 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Toluol-4-sulfonsaeure-(2,4-dibrom-anilid) |
| 2,4-dibromo-N-tosylaniline |
| p-Toluolsulfonsaeure-(2.4-dibrom-anilid) |
| (2,4-dibromophenyl)[(4-methylphenyl)sulfonyl]amine |
| toluene-4-sulfonic acid-(2,4-dibromo-anilide) |