tris[(2-methylpropan-2-yl)oxy]silylformonitrile structure
|
Common Name | tris[(2-methylpropan-2-yl)oxy]silylformonitrile | ||
|---|---|---|---|---|
| CAS Number | 110473-67-1 | Molecular Weight | 273.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris[(2-methylpropan-2-yl)oxy]silylformonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H27NO3Si |
|---|---|
| Molecular Weight | 273.44400 |
| Exact Mass | 273.17600 |
| PSA | 51.48000 |
| LogP | 3.43338 |
| InChIKey | YQQKEDKTJYOZLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Si](C#N)(OC(C)(C)C)OC(C)(C)C |
|
~%
tris[(2-methylp... CAS#:110473-67-1
Detail
|
| Literature: Hertler, Walter R.; Dixon, David A.; Matthews, Ellen W.; Davidson, Fredric; Kitson, Fulton G. Journal of the American Chemical Society, 1987 , vol. 109, # 21 p. 6532 - 6533 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| tri(tert-butoxy)silyl cyanide |
| Silanecarbonitrile,tris(1,1-dimethylethoxy) |