[[chloro(phenyl)methylidene]amino] 2,2-dichloroacetate structure
|
Common Name | [[chloro(phenyl)methylidene]amino] 2,2-dichloroacetate | ||
|---|---|---|---|---|
| CAS Number | 105755-38-2 | Molecular Weight | 266.50800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[chloro(phenyl)methylidene]amino] 2,2-dichloroacetate |
|---|
| Molecular Formula | C9H6Cl3NO2 |
|---|---|
| Molecular Weight | 266.50800 |
| Exact Mass | 264.94600 |
| PSA | 38.66000 |
| LogP | 2.93390 |
| InChIKey | LLEHTEPKBUAYKG-UHFFFAOYSA-N |
| SMILES | O=C(ON=C(Cl)c1ccccc1)C(Cl)Cl |
|
~%
[[chloro(phenyl... CAS#:105755-38-2 |
| Literature: Hegarty, Anthony F.; Mullane, Maria Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 995 - 1002 |
|
~%
[[chloro(phenyl... CAS#:105755-38-2 |
| Literature: Hegarty, Anthony F.; Mullane, Maria Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 995 - 1002 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |