3-isopropyl-4-methoxy-benzoic acid methyl ester
Modify Date: 2025-11-25 20:44:02
3-isopropyl-4-methoxy-benzoic acid methyl ester structure
|
Common Name | 3-isopropyl-4-methoxy-benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 105401-95-4 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-isopropyl-4-methoxy-benzoic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 35.53000 |
| LogP | 2.60520 |
| InChIKey | HOLNWNROAKMREJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c(C(C)C)c1 |
|
~%
3-isopropyl-4-m... CAS#:105401-95-4 |
| Literature: Sengupta et al. Journal of the Indian Chemical Society, 1959 , vol. 36, p. 659,665 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:16214-14-5| 3-Isopropyl-4-methoxy-benzoesaeure-methylester |