2-[2-(3-oxo-3-phenylpropanoyl)phenyl]acetic acid
Modify Date: 2025-09-26 14:27:29
![2-[2-(3-oxo-3-phenylpropanoyl)phenyl]acetic acid Structure](https://image.chemsrc.com/caspic/070/104907-58-6.png)
2-[2-(3-oxo-3-phenylpropanoyl)phenyl]acetic acid structure
|
Common Name | 2-[2-(3-oxo-3-phenylpropanoyl)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 104907-58-6 | Molecular Weight | 282.29100 | |
| Density | 1.258g/cm3 | Boiling Point | 520.8ºC at 760mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.9ºC | |
| Name | 2-[2-(3-oxo-3-phenylpropanoyl)phenyl]acetic acid |
|---|
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 520.8ºC at 760mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 282.9ºC |
| Exact Mass | 282.08900 |
| PSA | 71.44000 |
| LogP | 2.76940 |
| Vapour Pressure | 1.13E-11mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | XYENGEKQZFIJRA-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccccc1C(=O)CC(=O)c1ccccc1 |
|
~60%
2-[2-(3-oxo-3-p... CAS#:104907-58-6 |
| Literature: Watanabe; Date; Furukawa Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 2 p. 292 - 297 |
|
~%
2-[2-(3-oxo-3-p... CAS#:104907-58-6 |
| Literature: Watanabe, Katsuji; Taniguchi, Eiji Agricultural and Biological Chemistry, 1986 , vol. 50, # 8 p. 2047 - 2052 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |