3-methyl-6-propylpyrazolo[1,5-a]pyridine-4,7-dione structure
|
Common Name | 3-methyl-6-propylpyrazolo[1,5-a]pyridine-4,7-dione | ||
|---|---|---|---|---|
| CAS Number | 103240-15-9 | Molecular Weight | 204.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-6-propylpyrazolo[1,5-a]pyridine-4,7-dione |
|---|
| Molecular Formula | C11H12N2O2 |
|---|---|
| Molecular Weight | 204.22500 |
| Exact Mass | 204.09000 |
| PSA | 51.96000 |
| LogP | 1.75450 |
| InChIKey | QVJBDCVSIKKYPG-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=O)c2c(C)cnn2C1=O |
|
~%
3-methyl-6-prop... CAS#:103240-15-9 |
| Literature: Chan, Kin Shing; Wulff, William D. Journal of the American Chemical Society, 1986 , vol. 108, # 17 p. 5229 - 5236 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |