1,2-diethyl-4-nitrobenzene structure
|
Common Name | 1,2-diethyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 103095-31-4 | Molecular Weight | 179.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-diethyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO2 |
|---|---|
| Molecular Weight | 179.21600 |
| Exact Mass | 179.09500 |
| PSA | 45.82000 |
| LogP | 3.24280 |
| InChIKey | GUYZIRVMQNZWDJ-UHFFFAOYSA-N |
| SMILES | CCc1ccc([N+](=O)[O-])cc1CC |
|
~%
1,2-diethyl-4-n... CAS#:103095-31-4 |
| Literature: Lambooy Journal of the American Chemical Society, 1949 , vol. 71, p. 3758 |
|
~%
1,2-diethyl-4-n... CAS#:103095-31-4 |
| Literature: Alberti; Valcavi Gazzetta Chimica Italiana, 1957 , vol. 87, p. 329,339 |
|
~%
Detail
|
| Literature: Shen, Yu-sheng; Lui, Hong-xia; Chen, Yi-qiu Journal of Organic Chemistry, 1990 , vol. 55, # 12 p. 3961 - 3962 |
| 1,2-diethyl-4-nitro-benzene |
| Benzene,1,2-diethyl-4-nitro |
| 1,2-Diaethyl-4-nitro-benzol |