S-[2-oxo-2-[2,5,12-trihydroxy-4-[5-hydroxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl] propanethioate structure
|
Common Name | S-[2-oxo-2-[2,5,12-trihydroxy-4-[5-hydroxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl] propanethioate | ||
|---|---|---|---|---|
| CAS Number | 101980-70-5 | Molecular Weight | 711.65600 | |
| Density | 1.59g/cm3 | Boiling Point | 867.2ºC at 760mmHg | |
| Molecular Formula | C32H32F3NO12S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 478.2ºC | |
| Name | S-[2-oxo-2-[2,5,12-trihydroxy-4-[5-hydroxy-6-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]oxy-7-methoxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]ethyl] propanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 867.2ºC at 760mmHg |
| Molecular Formula | C32H32F3NO12S |
| Molecular Weight | 711.65600 |
| Flash Point | 478.2ºC |
| Exact Mass | 711.16000 |
| PSA | 231.29000 |
| LogP | 2.78950 |
| Vapour Pressure | 4.22E-32mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | NVULMDQUOVDNAC-UHFFFAOYSA-N |
| SMILES | CCC(=O)SCC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(OC2CC(NC(=O)C(F)(F)F)C(O)C(C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
|
~89%
S-[2-oxo-2-[2,5... CAS#:101980-70-5 |
| Literature: Seshadri; Idriss; Israel Journal of Medicinal Chemistry, 1986 , vol. 29, # 7 p. 1269 - 1273 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(trifluoroacetyl)adriamycin 14-thiobenzoate |
| Adriamycin 14-thioacetate |
| N-(trifluoroacetyl)adriamycin 14-thiopropionate |