aziridine,(2,4,5-trichlorophenyl) prop-2-enoate
Modify Date: 2025-09-01 16:37:12
aziridine,(2,4,5-trichlorophenyl) prop-2-enoate structure
|
Common Name | aziridine,(2,4,5-trichlorophenyl) prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 101952-47-0 | Molecular Weight | 294.56200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | aziridine,(2,4,5-trichlorophenyl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10Cl3NO2 |
|---|---|
| Molecular Weight | 294.56200 |
| Exact Mass | 292.97800 |
| PSA | 48.24000 |
| LogP | 3.65660 |
| Vapour Pressure | 0.000101mmHg at 25°C |
| InChIKey | HYDGUHWPIQWMIA-UHFFFAOYSA-N |
| SMILES | C1CN1.C=CC(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| Acrylic acid,2,4,5-trichlorophenyl ester compd. with aziridine |
| Reaction product of acrylic acid,2,4,5-trichlorophenyl ester and ethyleneimine |
| Aziridine,compd with 2,4,5-trichlorophenyl acrylate |