asudemotide structure
|
Common Name | asudemotide | ||
|---|---|---|---|---|
| CAS Number | 1018833-53-8 | Molecular Weight | 1189.313 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1602.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C58H80N10O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 923.0±34.3 °C | |
Use of asudemotideAsudemotide (S-588410) is a peptide of human DEP domain-containing protein 1A. Asudemotide is an immunostimulant. Asudemotide has a sequence of H-Glu-Tyr-Tyr-Glu-Leu-Phe-Val-Asn-Ile-OH. Asudemotide induces a tumor immune response in esophageal cancer. [1]. |
| Name | asudemotide |
|---|---|
| Synonym | More Synonyms |
| Description | Asudemotide (S-588410) is a peptide of human DEP domain-containing protein 1A. Asudemotide is an immunostimulant. Asudemotide has a sequence of H-Glu-Tyr-Tyr-Glu-Leu-Phe-Val-Asn-Ile-OH. Asudemotide induces a tumor immune response in esophageal cancer. [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1602.6±65.0 °C at 760 mmHg |
| Molecular Formula | C58H80N10O17 |
| Molecular Weight | 1189.313 |
| Flash Point | 923.0±34.3 °C |
| Exact Mass | 1188.570313 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FIURBSUJWCYXNV-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCC(=O)O)C(C)C)C(=O)O |
| 30Q33TZ6A7 |
| L-Isoleucine, L-α-glutamyl-L-tyrosyl-L-tyrosyl-L-α-glutamyl-L-leucyl-L-phenylalanyl-L-valyl-L-asparaginyl- |
| asudemotide |
| Isoleucine, L-α-glutamyl-L-tyrosyl-L-tyrosyl-L-α-glutamyl-L-leucylphenylalanyl-L-valyl-L-asparaginyl- |
| L-α-Glutamyl-L-tyrosyl-L-tyrosyl-L-α-glutamyl-L-leucylphenylalanyl-L-valyl-L-asparaginylisoleucine |
| L-α-Glutamyl-L-tyrosyl-L-tyrosyl-L-α-glutamyl-L-leucyl-L-phenylalanyl-L-valyl-L-asparaginyl-L-isoleucine |
| 9593 |