dibenzofuran,2,4,6-trinitrophenol
Modify Date: 2025-08-26 18:30:44
dibenzofuran,2,4,6-trinitrophenol structure
|
Common Name | dibenzofuran,2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 101606-96-6 | Molecular Weight | 397.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dibenzofuran,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H11N3O8 |
|---|---|
| Molecular Weight | 397.29500 |
| Exact Mass | 397.05500 |
| PSA | 170.83000 |
| LogP | 6.27240 |
| InChIKey | BSFDHWVBKGPIRN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc2c(c1)oc1ccccc12 |
| dibenzofuran,compound with picric acid |
| Dibenzofuran,Verbindung mit Picrinsaeure |
| Dibenzofuran,compd. with 2,4,6-trinitrophenol (1:1) |