1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyphthalazine
Modify Date: 2025-08-27 18:13:41
![1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyphthalazine Structure](https://image.chemsrc.com/caspic/445/10089-99-3.png)
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyphthalazine structure
|
Common Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyphthalazine | ||
|---|---|---|---|---|
| CAS Number | 10089-99-3 | Molecular Weight | 340.37300 | |
| Density | 1.192g/cm3 | Boiling Point | 534ºC at 760mmHg | |
| Molecular Formula | C19H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyphthalazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 534ºC at 760mmHg |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.37300 |
| Flash Point | 188ºC |
| Exact Mass | 340.14200 |
| PSA | 62.70000 |
| LogP | 3.25500 |
| Vapour Pressure | 6.07E-11mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | DFTALMINTYGFOX-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cc2nncc3cc(OC)c(OC)cc23)cc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Azapapaverine |
| 6,7-Dimethoxy-1-veratryl-phthalazin |
| Phthalazine,1-((3,4-dimethoxyphenyl)methyl)-6,7-dimethoxy |
| 1-(3,4-dimethoxy-benzyl)-6,7-dimethoxy-phthalazine |
| 6,7-dimethoxy-1-veratryl-phthalazine |