(4-tert-butylphenyl)phosphonic acid structure
|
Common Name | (4-tert-butylphenyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 100134-03-0 | Molecular Weight | 214.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-tert-butylphenyl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15O3P |
|---|---|
| Molecular Weight | 214.19800 |
| Exact Mass | 214.07600 |
| PSA | 67.34000 |
| LogP | 1.78710 |
| InChIKey | SYOFLEWUZXUEKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(P(=O)(O)O)cc1 |
|
~97%
(4-tert-butylph... CAS#:100134-03-0 |
| Literature: Yuan, Chengye; Feng, Hanzhen Synthesis, 1990 , # 2 p. 140 - 141 |
|
~%
(4-tert-butylph... CAS#:100134-03-0 |
| Literature: Kosolapoff Journal of the American Chemical Society, 1954 , vol. 76, p. 3222 |
|
~%
(4-tert-butylph... CAS#:100134-03-0 |
| Literature: Yuan, Chengye; Feng, Hanzhen Synthesis, 1990 , # 2 p. 140 - 141 |
|
~%
(4-tert-butylph... CAS#:100134-03-0 |
| Literature: Sheikh, Javeed Ahmad; Adhikary, Amit; Jena, Himanshu Sekhar; Biswas, Soumava; Konar, Sanjit Inorganic Chemistry, 2014 , vol. 53, # 3 p. 1606 - 1613 |
| (4-tert-Butyl-phenyl)-phosphonsaeure |
| p-tert-butylphenylphosphonic acid |
| (4-tert-butyl-phenyl)-phosphonic acid |
| p-tert.-Butylphenylphosphonsaeure |
| Phosphonic acid,[4-(1,1-dimethylethyl)phenyl] |