6-amino-5-(butylamino)-1-propylpyrimidine-2,4-dione structure
|
Common Name | 6-amino-5-(butylamino)-1-propylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 99991-93-2 | Molecular Weight | 240.30200 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-5-(butylamino)-1-propylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.30200 |
| Exact Mass | 240.15900 |
| PSA | 93.17000 |
| LogP | 1.80730 |
| Index of Refraction | 1.552 |
| InChIKey | NRFSRNQYQZSBOL-UHFFFAOYSA-N |
| SMILES | CCCCNc1c(N)n(CCC)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~%
6-amino-5-(buty... CAS#:99991-93-2 |
| Literature: Searle and Co. Patent: US2731465 , 1953 ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Amino-5-butylamino-1-propyl-1H-pyrimidin-2,4-dion |
| HMS2677A18 |
| 6-amino-5-(butylamino)-1-propylpyrimidine-2,4(1H,3H)-dione |
| 6-amino-5-butylamino-1-propyl-1H-pyrimidine-2,4-dione |