fema 2774
Modify Date: 2025-08-25 19:22:34
fema 2774 structure
|
Common Name | fema 2774 | ||
|---|---|---|---|---|
| CAS Number | 999-40-6 | Molecular Weight | 224.33900 | |
| Density | 0.897g/cm3 | Boiling Point | 299.9ºC at 760 mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 99.4ºC | |
| Name | (2Z)-3,7-dimethyl-2,6-octadien-1-yl butyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.897g/cm3 |
|---|---|
| Boiling Point | 299.9ºC at 760 mmHg |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | 99.4ºC |
| Exact Mass | 224.17800 |
| PSA | 26.30000 |
| LogP | 4.02240 |
| Index of Refraction | 1.46 |
| InChIKey | ZSBOMYJPSRFZAL-RAXLEYEMSA-N |
| SMILES | CCCC(=O)OCC=C(C)CCC=C(C)C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~99%
fema 2774 CAS#:999-40-6 |
| Literature: Green Chemistry, , vol. 14, # 11 p. 3026 - 3033 |
|
~%
fema 2774 CAS#:999-40-6 |
| Literature: Tetrahedron Letters, , vol. 31, # 34 p. 4875 - 4878 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| neryl butyrate |