3,4-dihydro-7-methoxy-2h-1-naphthalenone-o-tosyloxime
Modify Date: 2025-08-28 18:29:53
3,4-dihydro-7-methoxy-2h-1-naphthalenone-o-tosyloxime structure
|
Common Name | 3,4-dihydro-7-methoxy-2h-1-naphthalenone-o-tosyloxime | ||
|---|---|---|---|---|
| CAS Number | 99833-87-1 | Molecular Weight | 345.41300 | |
| Density | 1.26g/cm3 | Boiling Point | 509.1ºC at 760 mmHg | |
| Molecular Formula | C18H19NO4S | Melting Point | 133-134ºC | |
| MSDS | N/A | Flash Point | 261.7ºC | |
| Name | 3,4-dihydro-7-methoxy-2h-1-naphthalenone-o-tosyloxime |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 509.1ºC at 760 mmHg |
| Melting Point | 133-134ºC |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.41300 |
| Flash Point | 261.7ºC |
| Exact Mass | 345.10300 |
| PSA | 73.34000 |
| LogP | 4.53030 |
| Index of Refraction | 1.597 |
| InChIKey | JYVZHEYOQGNVJZ-VHEBQXMUSA-N |
| SMILES | COc1ccc2c(c1)C(=NOS(=O)(=O)c1ccc(C)cc1)CCC2 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |