methyl 5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate structure
|
Common Name | methyl 5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 99823-74-2 | Molecular Weight | 406.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17Cl2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5-(4-chlorophenyl)-2-[(4-chlorophenyl)carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate |
|---|
| Molecular Formula | C19H17Cl2N3O3 |
|---|---|
| Molecular Weight | 406.26300 |
| Exact Mass | 405.06500 |
| PSA | 71.00000 |
| LogP | 3.87100 |
| InChIKey | DYGFZLXVZHSAOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C)CN(C(=O)Nc2ccc(Cl)cc2)N=C1c1ccc(Cl)cc1 |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Rohm and Haas Company Patent: US4663341 A1, 1987 ; |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Rohm and Haas Company Patent: US4663341 A1, 1987 ; |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Rohm and Haas Company Patent: US4663341 A1, 1987 ; |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: ROHM AND HAAS COMPANY Patent: EP153127 B1, 1991 ; |
|
~95%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Rohm and Haas Patent: US4863947 A1, 1989 ; |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Hasan, Riaz; Nishimura, Keiichiro; Ueno, Tamio Pesticide Science, 1994 , vol. 42, # 4 p. 291 - 298 |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Hasan, Riaz; Nishimura, Keiichiro; Ueno, Tamio Pesticide Science, 1994 , vol. 42, # 4 p. 291 - 298 |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Hasan, Riaz; Nishimura, Keiichiro; Ueno, Tamio Pesticide Science, 1994 , vol. 42, # 4 p. 291 - 298 |
|
~%
methyl 5-(4-chl... CAS#:99823-74-2 |
| Literature: Hasan, Riaz; Nishimura, Keiichiro; Ueno, Tamio Pesticide Science, 1994 , vol. 42, # 4 p. 291 - 298 |