Esperamicin A1 structure
|
Common Name | Esperamicin A1 | ||
|---|---|---|---|---|
| CAS Number | 99674-26-7 | Molecular Weight | 1325.54000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H80N4O22S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Esperamicin A1Esperamicin A1, as an extremely potent antitumor antibiotic, is isolated from cultures of Actinomadura verrucosospora. Esperamicin A1 can be used for the research of antitumor[1]. |
| Name | esperamicin A1 |
|---|
| Description | Esperamicin A1, as an extremely potent antitumor antibiotic, is isolated from cultures of Actinomadura verrucosospora. Esperamicin A1 can be used for the research of antitumor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C59H80N4O22S4 |
|---|---|
| Molecular Weight | 1325.54000 |
| Exact Mass | 1324.41000 |
| PSA | 427.74000 |
| LogP | 4.66210 |
| InChIKey | LJQQFQHBKUKHIS-IIZLOWFNSA-N |
| SMILES | C=C(OC)C(=O)Nc1cc(OC)c(OC)cc1C(=O)OC1CC(OC2C(=O)C(NC(=O)OC)=C3C(=CCSSSC)C2(O)C#CC=CC#CC3OC2OC(C)C(NOC3CC(O)C(SC)C(C)O3)C(O)C2OC2CC(OC)C(NC(C)C)CO2)OC(C)C1O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |