(6-butyl-7-methoxy-1,5-dimethylindol-4-yl) acetate structure
|
Common Name | (6-butyl-7-methoxy-1,5-dimethylindol-4-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 99497-23-1 | Molecular Weight | 289.36900 | |
| Density | 1.08g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.9ºC | |
| Name | (6-butyl-7-methoxy-1,5-dimethylindol-4-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.36900 |
| Flash Point | 198.9ºC |
| Exact Mass | 289.16800 |
| PSA | 40.46000 |
| LogP | 3.76320 |
| Index of Refraction | 1.532 |
| InChIKey | GXNAEZBIVQOKEX-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)c(OC(C)=O)c2ccn(C)c2c1OC |
|
~%
(6-butyl-7-meth... CAS#:99497-23-1 |
| Literature: Yamashita; Schaub; Back; White; Toy; Ghazal; Burdick; Brashler; Holm Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 775 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-butyl-7-methoxy-1,5-dimethyl-1H-indol-4-yl acetate |