3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylic acid
Modify Date: 2025-10-10 21:43:42
3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylic acid structure
|
Common Name | 3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 99361-29-2 | Molecular Weight | 220.24800 | |
| Density | 1.52g/cm3 | Boiling Point | 363.8ºC at 760mmHg | |
| Molecular Formula | C10H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8ºC | |
| Name | 3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 363.8ºC at 760mmHg |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.24800 |
| Flash Point | 173.8ºC |
| Exact Mass | 220.03100 |
| PSA | 93.92000 |
| LogP | 1.85920 |
| Index of Refraction | 1.755 |
| InChIKey | YXIZTCTXXDBABW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c(=S)n1-c1ccccc1 |
| HS Code | 2933290090 |
|---|
|
~%
3-phenyl-2-sulf... CAS#:99361-29-2 |
| Literature: Jones Journal of the American Chemical Society, 1949 , vol. 71, p. 644,645 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-phenyl-2-thioxo-2,3-dihydro-1H-imidazole-4-carboxylic acid |
| 3-Phenyl-2-thioxo-2,3-dihydro-1H-imidazol-4-carbonsaeure |