N-[4-(2,4,6-trichlorophenoxy)phenyl]hydroxylamine structure
|
Common Name | N-[4-(2,4,6-trichlorophenoxy)phenyl]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 99226-42-3 | Molecular Weight | 304.55600 | |
| Density | 1.551g/cm3 | Boiling Point | 388.7ºC at 760mmHg | |
| Molecular Formula | C12H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | N-[4-(2,4,6-trichlorophenoxy)phenyl]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760mmHg |
| Molecular Formula | C12H8Cl3NO2 |
| Molecular Weight | 304.55600 |
| Flash Point | 188.9ºC |
| Exact Mass | 302.96200 |
| PSA | 41.49000 |
| LogP | 5.31320 |
| InChIKey | RSDNNUOBZFKBAK-UHFFFAOYSA-N |
| SMILES | ONc1ccc(Oc2c(Cl)cc(Cl)cc2Cl)cc1 |
|
~34%
N-[4-(2,4,6-tri... CAS#:99226-42-3 |
| Literature: Yoshioka, Tadao; Yamada, Hidetoshi; Uematsu, Takayoshi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1271 - 1276 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-hydroxy-4-(2,4,6-trichlorophenoxy)aniline |
| N-Hydroxy-4-(2,4,6-trichlorophenoxy)benzenamine |
| Benzenamine,N-hydroxy-4-(2,4,6-trichlorophenoxy) |