ethyl 5-(acetyloxymethyl)furan-2-carboxylate
Modify Date: 2024-01-11 04:51:32
ethyl 5-(acetyloxymethyl)furan-2-carboxylate structure
|
Common Name | ethyl 5-(acetyloxymethyl)furan-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 99187-01-6 | Molecular Weight | 212.19900 | |
| Density | 1.182g/cm3 | Boiling Point | 297.3ºC at 760mmHg | |
| Molecular Formula | C10H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.6ºC | |
| Name | ethyl 5-(acetyloxymethyl)furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 297.3ºC at 760mmHg |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.19900 |
| Flash Point | 133.6ºC |
| Exact Mass | 212.06800 |
| PSA | 65.74000 |
| LogP | 1.51940 |
| Index of Refraction | 1.479 |
| InChIKey | CLVLJVLDCHNKOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(COC(C)=O)o1 |
| HS Code | 2932190090 |
|---|
|
~87%
ethyl 5-(acetyl... CAS#:99187-01-6 |
| Literature: Hopf, Henning; Abhilash Synlett, 2009 , # 20 p. 3349 - 3351 |
|
~%
ethyl 5-(acetyl... CAS#:99187-01-6 |
| Literature: Mndshojan; Arojan Doklady Akademii Nauk Armyanskoi SSR, 1958 , vol. 27, p. 101,106 Chem.Abstr., 1959 , p. 18934 |
CAS#:6338-41-6
CAS#:76448-73-2| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| HMS563K05 |
| 5-acetoxymethyl-2-ethoxycarbonylfuran |
| 5-acetoxymethyl-furan-2-carboxylic acid ethyl ester |
| ethyl 5-(acetoxymethyl)-2-furoate |
| 5-Acetoxymethyl-furan-2-carbonsaeure-aethylester |
| ethyl 5-[(acetyloxy)methyl]-2-furoate |