Imiquimod (hydrochloride) structure
|
Common Name | Imiquimod (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 99011-78-6 | Molecular Weight | 276.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Imiquimod (hydrochloride)Imiquimod hydrochloride is an immune response modifier that acts as a toll-like receptor 7agonist. |
| Name | 1H-Imidazo[4,5-c]quinolin-4-amine, 1-(2-methylpropyl)-, hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Imiquimod hydrochloride is an immune response modifier that acts as a toll-like receptor 7agonist. |
|---|---|
| Related Catalog | |
| Target |
Toll-like receptor 7 |
| In Vivo | In animal models, imiquimod stimulates the innate immune response by increasing NK cell activity, activating macrophages to secretecytokines and nitric oxide, and inducing proliferation and differentiation of B lymphocytes. Imiquimod stimulates the innate immune response through induction, synthesis, and release of cytokines, including interferon-a (IFN-α), interleukin (IL)-6, and tumour necrosis factor (TNF)-α[1]. |
| References |
[1]. Bilu D, et al. Imiquimod: modes of action. Br J Dermatol. 2003 Nov;149 Suppl 66:5-8. |
| Molecular Formula | C14H17ClN4 |
|---|---|
| Molecular Weight | 276.76500 |
| Exact Mass | 276.11400 |
| PSA | 56.73000 |
| LogP | 4.20590 |
| InChIKey | RGKLRAHQVIHCCH-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1cnc2c(N)nc3ccccc3c21.Cl |
| Imiquimod (hydrochloride) |
| 1H-Imidazo[4,5-c]quinolin-4-amine, 1-(2-methylpropyl)-, monohydrochloride |
| Imiquimod hydrochloride |