2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol structure
|
Common Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 98661-43-9 | Molecular Weight | 295.37400 | |
| Density | 1.134g/cm3 | Boiling Point | 506.5ºC at 760 mmHg | |
| Molecular Formula | C16H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1ºC | |
| Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol |
|---|
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 506.5ºC at 760 mmHg |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.37400 |
| Flash Point | 260.1ºC |
| Exact Mass | 295.17800 |
| PSA | 70.95000 |
| LogP | 1.60040 |
| Index of Refraction | 1.536 |
| InChIKey | DLPCTIQNIDHILA-UHFFFAOYSA-N |
| SMILES | CCOc1cc2c(cc1OCC)C(C(CO)CO)NCC2 |
| HS Code | 2933499090 |
|---|
|
~90%
2-(6,7-diethoxy... CAS#:98661-43-9 |
| Literature: Kobor, Jeno; Fueloep, Ferenc; Bernath, Gabor Heterocycles, 1986 , vol. 24, # 8 p. 2227 - 2231 |
|
~%
2-(6,7-diethoxy... CAS#:98661-43-9 |
| Literature: Kobor, Jeno; Fueloep, Ferenc; Bernath, Gabor Heterocycles, 1986 , vol. 24, # 8 p. 2227 - 2231 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |